C13H23FN2 — CID 143062711
(E)-N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)-3-fluoropent-2-en-1-amine (PubChem CID 143062711) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is (E)-N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)-3-fluoropent-2-en-1-amine.
| Compound Name | (E)-N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)-3-fluoropent-2-en-1-amine |
|---|---|
| PubChem CID | 143062711 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (E)-N-(8-azabicyclo[3.2.1]octan-3-ylmethyl)-3-fluoropent-2-en-1-amine |
| SMILES | CC/C(F)=C\CNCC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C13H23FN2/c1-2-11(14)5-6-15-9-10-7-12-3-4-13(8-10)16-12/h5,10,12-13,15-16H,2-4,6-9H2,1H3/b11-5+ |
| InChIKey | KYIISGYSQLHSED-VZUCSPMQSA-N |
| XLogP | 2.37 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|