C20H30N4O2 — CID 143063190
ethyl 1-ethyl-2-(3-piperidin-1-ylpropylamino)benzimidazole-5-carboxylate (PubChem CID 143063190) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is ethyl 1-ethyl-2-(3-piperidin-1-ylpropylamino)benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-ethyl-2-(3-piperidin-1-ylpropylamino)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 143063190 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | ethyl 1-ethyl-2-(3-piperidin-1-ylpropylamino)benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(NCCCN1CCCCC1)n2CC |
| InChI | InChI=1S/C20H30N4O2/c1-3-24-18-10-9-16(19(25)26-4-2)15-17(18)22-20(24)21-11-8-14-23-12-6-5-7-13-23/h9-10,15H,3-8,11-14H2,1-2H3,(H,21,22) |
| InChIKey | ZWGPCIOARWFEGF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|