C30H39Cl3N4 — CID 143063656
(E)-N-[(E)-[5-chloro-1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]spiro[2H-indene-3,4'-piperidine]-1-ylidene]amino]but-2-en-1-amine;1-chloroethenamine;ethane (PubChem CID 143063656) has the molecular formula C30H39Cl3N4 and a molecular weight of 562.03 g/mol. Its IUPAC name is (E)-N-[(E)-[5-chloro-1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]spiro[2H-indene-3,4'-piperidine]-1-ylidene]amino]but-2-en-1-amine;1-chloroethenamine;ethane.
| Compound Name | (E)-N-[(E)-[5-chloro-1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]spiro[2H-indene-3,4'-piperidine]-1-ylidene]amino]but-2-en-1-amine;1-chloroethenamine;ethane |
|---|---|
| PubChem CID | 143063656 |
| Molecular Formula | C30H39Cl3N4 |
| Molecular Weight | 562.03 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | (E)-N-[(E)-[5-chloro-1'-[(E)-3-(4-chlorophenyl)prop-2-enyl]spiro[2H-indene-3,4'-piperidine]-1-ylidene]amino]but-2-en-1-amine;1-chloroethenamine;ethane |
| SMILES | C/C=C/CN/N=C1\CC2(CCN(C/C=C/c3ccc(Cl)cc3)CC2)c2cc(Cl)ccc21.C=C(N)Cl.CC |
| InChI | InChI=1S/C26H29Cl2N3.C2H4ClN.C2H6/c1-2-3-14-29-30-25-19-26(24-18-22(28)10-11-23(24)25)12-16-31(17-13-26)15-4-5-20-6-8-21(27)9-7-20;1-2(3)4;1-2/h2-11,18,29H,12-17,19H2,1H3;1,4H2;1-2H3/b3-2+,5-4+,30-25+;; |
| InChIKey | HROHFQULNABXDT-PWZPUFRQSA-N |
| XLogP | 8.00 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.03 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|