C17H19N3O5S2 — CID 143065043
2-[[5-[(E)-(C,N-dimethylcarbonimidoyl)oxyiminomethyl]thiophen-2-yl]sulfonylamino]-3-phenylpropanoic acid (PubChem CID 143065043) has the molecular formula C17H19N3O5S2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[[5-[(E)-(C,N-dimethylcarbonimidoyl)oxyiminomethyl]thiophen-2-yl]sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[[5-[(E)-(C,N-dimethylcarbonimidoyl)oxyiminomethyl]thiophen-2-yl]sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 143065043 |
| Molecular Formula | C17H19N3O5S2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | 2-[[5-[(E)-(C,N-dimethylcarbonimidoyl)oxyiminomethyl]thiophen-2-yl]sulfonylamino]-3-phenylpropanoic acid |
| SMILES | C/N=C(\C)O/N=C/c1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)O)s1 |
| InChI | InChI=1S/C17H19N3O5S2/c1-12(18-2)25-19-11-14-8-9-16(26-14)27(23,24)20-15(17(21)22)10-13-6-4-3-5-7-13/h3-9,11,15,20H,10H2,1-2H3,(H,21,22)/b18-12+,19-11+ |
| InChIKey | YIVRXGBSHCOXES-IDXRHMDNSA-N |
| XLogP | 2.12 |
| TPSA | 117.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|