C30H34Cl2N4O5 — CID 143067424
propan-2-yl (2S,4E,6E)-2-[(2,6-dichlorobenzoyl)amino]-4-methyl-7-[1-methyl-6-(methylaminomethyl)-2,4-dioxoquinazolin-3-yl]octa-4,6-dienoate (PubChem CID 143067424) has the molecular formula C30H34Cl2N4O5 and a molecular weight of 601.53 g/mol. Its IUPAC name is propan-2-yl (2S,4E,6E)-2-[(2,6-dichlorobenzoyl)amino]-4-methyl-7-[1-methyl-6-(methylaminomethyl)-2,4-dioxoquinazolin-3-yl]octa-4,6-dienoate.
| Compound Name | propan-2-yl (2S,4E,6E)-2-[(2,6-dichlorobenzoyl)amino]-4-methyl-7-[1-methyl-6-(methylaminomethyl)-2,4-dioxoquinazolin-3-yl]octa-4,6-dienoate |
|---|---|
| PubChem CID | 143067424 |
| Molecular Formula | C30H34Cl2N4O5 |
| Molecular Weight | 601.53 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | propan-2-yl (2S,4E,6E)-2-[(2,6-dichlorobenzoyl)amino]-4-methyl-7-[1-methyl-6-(methylaminomethyl)-2,4-dioxoquinazolin-3-yl]octa-4,6-dienoate |
| SMILES | CNCc1ccc2c(c1)c(=O)n(/C(C)=C/C=C(\C)C[C@H](NC(=O)c1c(Cl)cccc1Cl)C(=O)OC(C)C)c(=O)n2C |
| InChI | InChI=1S/C30H34Cl2N4O5/c1-17(2)41-29(39)24(34-27(37)26-22(31)8-7-9-23(26)32)14-18(3)10-11-19(4)36-28(38)21-15-20(16-33-5)12-13-25(21)35(6)30(36)40/h7-13,15,17,24,33H,14,16H2,1-6H3,(H,34,37)/b18-10+,19-11+/t24-/m0/s1 |
| InChIKey | MJOZOFGOXJLFCZ-CVPHLGEESA-N |
| XLogP | 4.67 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|