C32H34Cl2N4O5 — CID 154544388
propan-2-yl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[1-methyl-2,4-dioxo-7-(propylaminomethyl)quinazolin-3-yl]phenyl]propanoate (PubChem CID 154544388) has the molecular formula C32H34Cl2N4O5 and a molecular weight of 625.55 g/mol. Its IUPAC name is propan-2-yl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[1-methyl-2,4-dioxo-7-(propylaminomethyl)quinazolin-3-yl]phenyl]propanoate.
| Compound Name | propan-2-yl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[1-methyl-2,4-dioxo-7-(propylaminomethyl)quinazolin-3-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 154544388 |
| Molecular Formula | C32H34Cl2N4O5 |
| Molecular Weight | 625.55 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | propan-2-yl 2-[(2,6-dichlorobenzoyl)amino]-3-[4-[1-methyl-2,4-dioxo-7-(propylaminomethyl)quinazolin-3-yl]phenyl]propanoate |
| SMILES | CCCNCc1ccc2c(=O)n(-c3ccc(CC(NC(=O)c4c(Cl)cccc4Cl)C(=O)OC(C)C)cc3)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C32H34Cl2N4O5/c1-5-15-35-18-21-11-14-23-27(17-21)37(4)32(42)38(30(23)40)22-12-9-20(10-13-22)16-26(31(41)43-19(2)3)36-29(39)28-24(33)7-6-8-25(28)34/h6-14,17,19,26,35H,5,15-16,18H2,1-4H3,(H,36,39) |
| InChIKey | SYWHEUJJQBJFDA-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.55 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|