C27H22Cl2IN3O5 — CID 91470365
propan-2-yl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)phenyl]propanoate (PubChem CID 91470365) has the molecular formula C27H22Cl2IN3O5 and a molecular weight of 666.30 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)phenyl]propanoate.
| Compound Name | propan-2-yl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 91470365 |
| Molecular Formula | C27H22Cl2IN3O5 |
| Molecular Weight | 666.30 g/mol |
| Exact Mass | 665.00 |
| IUPAC Name | propan-2-yl (2S)-2-[(2,6-dichlorobenzoyl)amino]-3-[4-(6-iodo-2,4-dioxo-1H-quinazolin-3-yl)phenyl]propanoate |
| SMILES | CC(C)OC(=O)[C@H](Cc1ccc(-n2c(=O)[nH]c3ccc(I)cc3c2=O)cc1)NC(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C27H22Cl2IN3O5/c1-14(2)38-26(36)22(31-24(34)23-19(28)4-3-5-20(23)29)12-15-6-9-17(10-7-15)33-25(35)18-13-16(30)8-11-21(18)32-27(33)37/h3-11,13-14,22H,12H2,1-2H3,(H,31,34)(H,32,37)/t22-/m0/s1 |
| InChIKey | OFACSKMOLIJGJW-QFIPXVFZSA-N |
| XLogP | 4.88 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.30 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|