C22H24N2O4 — CID 171677042
propan-2-yl (2S)-3-(4-hydroxyphenyl)-2-[(4-methyl-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 171677042) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is propan-2-yl (2S)-3-(4-hydroxyphenyl)-2-[(4-methyl-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | propan-2-yl (2S)-3-(4-hydroxyphenyl)-2-[(4-methyl-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 171677042 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | propan-2-yl (2S)-3-(4-hydroxyphenyl)-2-[(4-methyl-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | Cc1cccc2[nH]c(C(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)OC(C)C)cc12 |
| InChI | InChI=1S/C22H24N2O4/c1-13(2)28-22(27)20(11-15-7-9-16(25)10-8-15)24-21(26)19-12-17-14(3)5-4-6-18(17)23-19/h4-10,12-13,20,23,25H,11H2,1-3H3,(H,24,26)/t20-/m0/s1 |
| InChIKey | VRPNVVAHKUGLAG-FQEVSTJZSA-N |
| XLogP | 3.47 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |