C18H14FIN2O3 — CID 164610657
(2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-iodophenyl)propanoic acid (PubChem CID 164610657) has the molecular formula C18H14FIN2O3 and a molecular weight of 452.22 g/mol. Its IUPAC name is (2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-iodophenyl)propanoic acid.
| Compound Name | (2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 164610657 |
| Molecular Formula | C18H14FIN2O3 |
| Molecular Weight | 452.22 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | (2S)-2-[(4-fluoro-1H-indole-2-carbonyl)amino]-3-(4-iodophenyl)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(I)cc1)C(=O)O)c1cc2c(F)cccc2[nH]1 |
| InChI | InChI=1S/C18H14FIN2O3/c19-13-2-1-3-14-12(13)9-15(21-14)17(23)22-16(18(24)25)8-10-4-6-11(20)7-5-10/h1-7,9,16,21H,8H2,(H,22,23)(H,24,25)/t16-/m0/s1 |
| InChIKey | CPRKPQCWJTUWSM-INIZCTEOSA-N |
| XLogP | 3.34 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.22 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|