C17H19ClN4O2 — CID 143071510
N-(4-amino-5-hydroxy-2-methylphenyl)-2-methylprop-2-enamide;3-chloro-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene (PubChem CID 143071510) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is N-(4-amino-5-hydroxy-2-methylphenyl)-2-methylprop-2-enamide;3-chloro-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene.
| Compound Name | N-(4-amino-5-hydroxy-2-methylphenyl)-2-methylprop-2-enamide;3-chloro-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene |
|---|---|
| PubChem CID | 143071510 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | N-(4-amino-5-hydroxy-2-methylphenyl)-2-methylprop-2-enamide;3-chloro-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-triene |
| SMILES | C=C(C)C(=O)Nc1cc(O)c(N)cc1C.Clc1ccc2[nH][nH]c2c1 |
| InChI | InChI=1S/C11H14N2O2.C6H5ClN2/c1-6(2)11(15)13-9-5-10(14)8(12)4-7(9)3;7-4-1-2-5-6(3-4)9-8-5/h4-5,14H,1,12H2,2-3H3,(H,13,15);1-3,8-9H |
| InChIKey | OSTOORIGIKEQKL-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|