C26H49N3 — CID 143071721
(3Z,5Z)-5-(4-butylpiperazin-1-yl)-N-heptyl-6,8-dimethylnona-1,3,5-trien-2-amine (PubChem CID 143071721) has the molecular formula C26H49N3 and a molecular weight of 403.70 g/mol. Its IUPAC name is (3Z,5Z)-5-(4-butylpiperazin-1-yl)-N-heptyl-6,8-dimethylnona-1,3,5-trien-2-amine.
| Compound Name | (3Z,5Z)-5-(4-butylpiperazin-1-yl)-N-heptyl-6,8-dimethylnona-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 143071721 |
| Molecular Formula | C26H49N3 |
| Molecular Weight | 403.70 g/mol |
| Exact Mass | 403.39 |
| IUPAC Name | (3Z,5Z)-5-(4-butylpiperazin-1-yl)-N-heptyl-6,8-dimethylnona-1,3,5-trien-2-amine |
| SMILES | C=C(/C=C\C(=C(/C)CC(C)C)N1CCN(CCCC)CC1)NCCCCCCC |
| InChI | InChI=1S/C26H49N3/c1-7-9-11-12-13-16-27-25(6)14-15-26(24(5)22-23(3)4)29-20-18-28(19-21-29)17-10-8-2/h14-15,23,27H,6-13,16-22H2,1-5H3/b15-14-,26-24- |
| InChIKey | PQONRBWNRQYDLR-JYWRQANJSA-N |
| XLogP | 6.35 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.70 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|