C24H34N4O9 — CID 143071995
2-[4,10-bis(carboxymethyl)-7-formyl-1,4,7,10-tetrazacyclododec-1-yl]-4-oxo-4-phenylmethoxybutanoic acid (PubChem CID 143071995) has the molecular formula C24H34N4O9 and a molecular weight of 522.56 g/mol. Its IUPAC name is 2-[4,10-bis(carboxymethyl)-7-formyl-1,4,7,10-tetrazacyclododec-1-yl]-4-oxo-4-phenylmethoxybutanoic acid.
| Compound Name | 2-[4,10-bis(carboxymethyl)-7-formyl-1,4,7,10-tetrazacyclododec-1-yl]-4-oxo-4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 143071995 |
| Molecular Formula | C24H34N4O9 |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 2-[4,10-bis(carboxymethyl)-7-formyl-1,4,7,10-tetrazacyclododec-1-yl]-4-oxo-4-phenylmethoxybutanoic acid |
| SMILES | O=CN1CCN(CC(=O)O)CCN(C(CC(=O)OCc2ccccc2)C(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C24H34N4O9/c29-18-27-8-6-25(15-21(30)31)10-12-28(13-11-26(7-9-27)16-22(32)33)20(24(35)36)14-23(34)37-17-19-4-2-1-3-5-19/h1-5,18,20H,6-17H2,(H,30,31)(H,32,33)(H,35,36) |
| InChIKey | JYJBVVOUOIRDLQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 168.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|