C8H11NS — CID 143072353
5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-thiazine (PubChem CID 143072353) has the molecular formula C8H11NS and a molecular weight of 153.25 g/mol. Its IUPAC name is 5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-thiazine.
| Compound Name | 5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-thiazine |
|---|---|
| PubChem CID | 143072353 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 5,6-bis(ethenyl)-3,4-dihydro-2H-1,4-thiazine |
| SMILES | C=CC1=C(C=C)SCCN1 |
| InChI | InChI=1S/C8H11NS/c1-3-7-8(4-2)10-6-5-9-7/h3-4,9H,1-2,5-6H2 |
| InChIKey | SSQUVOFWBVUVDB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |