About 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole
4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole (PubChem CID 142208699) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole.
Analyze 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole?
The IUPAC name of 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole (CID 142208699) is 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole is C=CC1=C(C=C)SC(C)N1.
What is the InChIKey of 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole?
The InChIKey is XDFSJCUOORVXLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-4-7-8(5-2)10-6(3)9-7/h4-6,9H,1-2H2,3H3.
What are the key properties of 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole?
4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole has a molecular weight of 153.25 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-2-methyl-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 142208699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).