C9H13NS — CID 89319225
(2R,5E)-2-methyl-5-[(2Z)-penta-2,4-dienylidene]-1,3-thiazolidine (PubChem CID 89319225) has the molecular formula C9H13NS and a molecular weight of 167.28 g/mol. Its IUPAC name is (2R,5E)-2-methyl-5-[(2Z)-penta-2,4-dienylidene]-1,3-thiazolidine.
| Compound Name | (2R,5E)-2-methyl-5-[(2Z)-penta-2,4-dienylidene]-1,3-thiazolidine |
|---|---|
| PubChem CID | 89319225 |
| Molecular Formula | C9H13NS |
| Molecular Weight | 167.28 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (2R,5E)-2-methyl-5-[(2Z)-penta-2,4-dienylidene]-1,3-thiazolidine |
| SMILES | C=C/C=C\C=C1/CN[C@@H](C)S1 |
| InChI | InChI=1S/C9H13NS/c1-3-4-5-6-9-7-10-8(2)11-9/h3-6,8,10H,1,7H2,2H3/b5-4-,9-6+/t8-/m1/s1 |
| InChIKey | SITIPMCULWOUBL-GBXSPLGYSA-N |
| XLogP | 2.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|