C17H15F2NO — CID 143074172
(2,4-difluorophenyl)-(3-ethyl-2,3-dihydroindol-1-yl)methanone (PubChem CID 143074172) has the molecular formula C17H15F2NO and a molecular weight of 287.31 g/mol. Its IUPAC name is (2,4-difluorophenyl)-(3-ethyl-2,3-dihydroindol-1-yl)methanone.
| Compound Name | (2,4-difluorophenyl)-(3-ethyl-2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 143074172 |
| Molecular Formula | C17H15F2NO |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | (2,4-difluorophenyl)-(3-ethyl-2,3-dihydroindol-1-yl)methanone |
| SMILES | CCC1CN(C(=O)c2ccc(F)cc2F)c2ccccc21 |
| InChI | InChI=1S/C17H15F2NO/c1-2-11-10-20(16-6-4-3-5-13(11)16)17(21)14-8-7-12(18)9-15(14)19/h3-9,11H,2,10H2,1H3 |
| InChIKey | KSXCATLCEGGMNW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |