C17H12F3NO3 — CID 75377070
methyl 1-(2,3,4-trifluorobenzoyl)-2,3-dihydroindole-3-carboxylate (PubChem CID 75377070) has the molecular formula C17H12F3NO3 and a molecular weight of 335.28 g/mol. Its IUPAC name is methyl 1-(2,3,4-trifluorobenzoyl)-2,3-dihydroindole-3-carboxylate.
| Compound Name | methyl 1-(2,3,4-trifluorobenzoyl)-2,3-dihydroindole-3-carboxylate |
|---|---|
| PubChem CID | 75377070 |
| Molecular Formula | C17H12F3NO3 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | methyl 1-(2,3,4-trifluorobenzoyl)-2,3-dihydroindole-3-carboxylate |
| SMILES | COC(=O)C1CN(C(=O)c2ccc(F)c(F)c2F)c2ccccc21 |
| InChI | InChI=1S/C17H12F3NO3/c1-24-17(23)11-8-21(13-5-3-2-4-9(11)13)16(22)10-6-7-12(18)15(20)14(10)19/h2-7,11H,8H2,1H3 |
| InChIKey | DEKKDLNAKXWOMO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|