C24H39N3O2S — CID 143074893
3-[(1E)-1-[(Z)-but-2-en-2-yl]sulfanylbuta-1,3-dienyl]-1-cycloheptyl-1-(1-propanoylpiperidin-4-yl)urea (PubChem CID 143074893) has the molecular formula C24H39N3O2S and a molecular weight of 433.66 g/mol. Its IUPAC name is 3-[(1E)-1-[(Z)-but-2-en-2-yl]sulfanylbuta-1,3-dienyl]-1-cycloheptyl-1-(1-propanoylpiperidin-4-yl)urea.
| Compound Name | 3-[(1E)-1-[(Z)-but-2-en-2-yl]sulfanylbuta-1,3-dienyl]-1-cycloheptyl-1-(1-propanoylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 143074893 |
| Molecular Formula | C24H39N3O2S |
| Molecular Weight | 433.66 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | 3-[(1E)-1-[(Z)-but-2-en-2-yl]sulfanylbuta-1,3-dienyl]-1-cycloheptyl-1-(1-propanoylpiperidin-4-yl)urea |
| SMILES | C=C/C=C(\NC(=O)N(C1CCCCCC1)C1CCN(C(=O)CC)CC1)S/C(C)=C\C |
| InChI | InChI=1S/C24H39N3O2S/c1-5-12-22(30-19(4)6-2)25-24(29)27(20-13-10-8-9-11-14-20)21-15-17-26(18-16-21)23(28)7-3/h5-6,12,20-21H,1,7-11,13-18H2,2-4H3,(H,25,29)/b19-6-,22-12+ |
| InChIKey | AKMKUBVPVGLHRT-LFVOAOAZSA-N |
| XLogP | 5.81 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|