C20H29ClN4O3 — CID 143075390
1-(5-chloro-2-methoxyphenyl)-3-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]urea (PubChem CID 143075390) has the molecular formula C20H29ClN4O3 and a molecular weight of 408.93 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 143075390 |
| Molecular Formula | C20H29ClN4O3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[2-oxo-2-(4-piperidin-1-ylpiperidin-1-yl)ethyl]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NCC(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C20H29ClN4O3/c1-28-18-6-5-15(21)13-17(18)23-20(27)22-14-19(26)25-11-7-16(8-12-25)24-9-3-2-4-10-24/h5-6,13,16H,2-4,7-12,14H2,1H3,(H2,22,23,27) |
| InChIKey | IXOWRYGAHIPJNJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |