About (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol
(Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol (PubChem CID 143076476) has the molecular formula C12H24O2
and a molecular weight of 200.32 g/mol. Its IUPAC name is (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol.
Molecular Properties
| Compound Name | (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol |
| PubChem CID | 143076476 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol |
| SMILES | CC/C=C(\OCC)C(O)C(C)(C)CC |
| InChI | InChI=1S/C12H24O2/c1-6-9-10(14-8-3)11(13)12(4,5)7-2/h9,11,13H,6-8H2,1-5H3/b10-9- |
| InChIKey | VPJCOLJAOGKMTA-KTKRTIGZSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol?
The IUPAC name of (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol (CID 143076476) is (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol.
What is the SMILES notation for (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol?
The canonical SMILES for (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol is CC/C=C(\OCC)C(O)C(C)(C)CC.
What is the InChIKey of (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol?
The InChIKey is VPJCOLJAOGKMTA-KTKRTIGZSA-N. The full InChI is InChI=1S/C12H24O2/c1-6-9-10(14-8-3)11(13)12(4,5)7-2/h9,11,13H,6-8H2,1-5H3/b10-9-.
What are the key properties of (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol?
(Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol has a molecular weight of 200.32 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol is sourced from PubChem (CID 143076476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).