C12H24O2 — CID 143076476
(Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol (PubChem CID 143076476) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol.
| Compound Name | (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol |
|---|---|
| PubChem CID | 143076476 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (Z)-5-ethoxy-3,3-dimethyloct-5-en-4-ol |
| SMILES | CC/C=C(\OCC)C(O)C(C)(C)CC |
| InChI | InChI=1S/C12H24O2/c1-6-9-10(14-8-3)11(13)12(4,5)7-2/h9,11,13H,6-8H2,1-5H3/b10-9- |
| InChIKey | VPJCOLJAOGKMTA-KTKRTIGZSA-N |
| XLogP | 3.11 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|