C11H22O3 — CID 93476510
(3S)-1,1-diethoxy-4,4-dimethylpent-1-en-3-ol (PubChem CID 93476510) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is (3S)-1,1-diethoxy-4,4-dimethylpent-1-en-3-ol.
| Compound Name | (3S)-1,1-diethoxy-4,4-dimethylpent-1-en-3-ol |
|---|---|
| PubChem CID | 93476510 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | (3S)-1,1-diethoxy-4,4-dimethylpent-1-en-3-ol |
| SMILES | CCOC(=C[C@H](O)C(C)(C)C)OCC |
| InChI | InChI=1S/C11H22O3/c1-6-13-10(14-7-2)8-9(12)11(3,4)5/h8-9,12H,6-7H2,1-5H3/t9-/m0/s1 |
| InChIKey | CNEVMGLWXAXEAK-VIFPVBQESA-N |
| XLogP | 2.31 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|