C13H28O5Ti — CID 146899661
1-methoxy-4,4-dimethylpent-1-ene-1,3-diol;pentane-2,4-diol;titanium (PubChem CID 146899661) has the molecular formula C13H28O5Ti and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-methoxy-4,4-dimethylpent-1-ene-1,3-diol;pentane-2,4-diol;titanium.
| Compound Name | 1-methoxy-4,4-dimethylpent-1-ene-1,3-diol;pentane-2,4-diol;titanium |
|---|---|
| PubChem CID | 146899661 |
| Molecular Formula | C13H28O5Ti |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 1-methoxy-4,4-dimethylpent-1-ene-1,3-diol;pentane-2,4-diol;titanium |
| SMILES | CC(O)CC(C)O.COC(O)=CC(O)C(C)(C)C.[Ti] |
| InChI | InChI=1S/C8H16O3.C5H12O2.Ti/c1-8(2,3)6(9)5-7(10)11-4;1-4(6)3-5(2)7;/h5-6,9-10H,1-4H3;4-7H,3H2,1-2H3; |
| InChIKey | UILBPZYIKYYIEQ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|