C24H36N6O4S3 — CID 143076585
acetylene;2-(4-methylpiperazin-1-yl)sulfonyl-4-[[4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;propane (PubChem CID 143076585) has the molecular formula C24H36N6O4S3 and a molecular weight of 568.79 g/mol. Its IUPAC name is acetylene;2-(4-methylpiperazin-1-yl)sulfonyl-4-[[4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;propane.
| Compound Name | acetylene;2-(4-methylpiperazin-1-yl)sulfonyl-4-[[4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;propane |
|---|---|
| PubChem CID | 143076585 |
| Molecular Formula | C24H36N6O4S3 |
| Molecular Weight | 568.79 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | acetylene;2-(4-methylpiperazin-1-yl)sulfonyl-4-[[4-[(4-propan-2-ylfuran-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol;propane |
| SMILES | C#C.CC(C)c1coc(CNc2nsnc2Nc2csc(S(=O)(=O)N3CCN(C)CC3)c2O)c1.CCC |
| InChI | InChI=1S/C19H26N6O4S3.C3H8.C2H2/c1-12(2)13-8-14(29-10-13)9-20-17-18(23-31-22-17)21-15-11-30-19(16(15)26)32(27,28)25-6-4-24(3)5-7-25;1-3-2;1-2/h8,10-12,26H,4-7,9H2,1-3H3,(H,20,22)(H,21,23);3H2,1-2H3;1-2H |
| InChIKey | WLSYNCNQCJXFEM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 123.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.79 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|