C22H33N7O4S3 — CID 143077239
N-ethyl-3-hydroxy-4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophene-2-sulfonamide (PubChem CID 143077239) has the molecular formula C22H33N7O4S3 and a molecular weight of 555.75 g/mol. Its IUPAC name is N-ethyl-3-hydroxy-4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophene-2-sulfonamide.
| Compound Name | N-ethyl-3-hydroxy-4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 143077239 |
| Molecular Formula | C22H33N7O4S3 |
| Molecular Weight | 555.75 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | N-ethyl-3-hydroxy-4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophene-2-sulfonamide |
| SMILES | CCNS(=O)(=O)c1scc(Nc2nsnc2NCc2cc(CCCCN3CCN(C)CC3)co2)c1O |
| InChI | InChI=1S/C22H33N7O4S3/c1-3-24-36(31,32)22-19(30)18(15-34-22)25-21-20(26-35-27-21)23-13-17-12-16(14-33-17)6-4-5-7-29-10-8-28(2)9-11-29/h12,14-15,24,30H,3-11,13H2,1-2H3,(H,23,26)(H,25,27) |
| InChIKey | NCUHXNWIUFGJFL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.75 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|