C31H50N8O4S3 — CID 143077258
acetylene;4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-(4-methylpiperazin-1-yl)sulfonylthiophen-3-ol;2-methylpropane (PubChem CID 143077258) has the molecular formula C31H50N8O4S3 and a molecular weight of 694.99 g/mol. Its IUPAC name is acetylene;4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-(4-methylpiperazin-1-yl)sulfonylthiophen-3-ol;2-methylpropane.
| Compound Name | acetylene;4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-(4-methylpiperazin-1-yl)sulfonylthiophen-3-ol;2-methylpropane |
|---|---|
| PubChem CID | 143077258 |
| Molecular Formula | C31H50N8O4S3 |
| Molecular Weight | 694.99 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | acetylene;4-[[4-[[4-[4-(4-methylpiperazin-1-yl)butyl]furan-2-yl]methylamino]-1,2,5-thiadiazol-3-yl]amino]-2-(4-methylpiperazin-1-yl)sulfonylthiophen-3-ol;2-methylpropane |
| SMILES | C#C.CC(C)C.CN1CCN(CCCCc2coc(CNc3nsnc3Nc3csc(S(=O)(=O)N4CCN(C)CC4)c3O)c2)CC1 |
| InChI | InChI=1S/C25H38N8O4S3.C4H10.C2H2/c1-30-7-11-32(12-8-30)6-4-3-5-19-15-20(37-17-19)16-26-23-24(29-39-28-23)27-21-18-38-25(22(21)34)40(35,36)33-13-9-31(2)10-14-33;1-4(2)3;1-2/h15,17-18,34H,3-14,16H2,1-2H3,(H,26,28)(H,27,29);4H,1-3H3;1-2H |
| InChIKey | CVZFACDZGVJFHP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.99 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|