C26H31N7O3 — CID 143077108
1-N'-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide (PubChem CID 143077108) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is 1-N'-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide.
| Compound Name | 1-N'-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide |
|---|---|
| PubChem CID | 143077108 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | 1-N'-[2-hydroxy-3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]-2-N'-[(1R)-1-(4-methylfuran-2-yl)propyl]ethanediimidamide |
| SMILES | CC[C@@H](/N=C(N)/C(N)=N/c1cccc(C(=O)N2CCN(c3ccccn3)CC2)c1O)c1cc(C)co1 |
| InChI | InChI=1S/C26H31N7O3/c1-3-19(21-15-17(2)16-36-21)30-24(27)25(28)31-20-8-6-7-18(23(20)34)26(35)33-13-11-32(12-14-33)22-9-4-5-10-29-22/h4-10,15-16,19,34H,3,11-14H2,1-2H3,(H2,27,30)(H2,28,31)/t19-/m1/s1 |
| InChIKey | RJVMCTKHHJHMMD-LJQANCHMSA-N |
| XLogP | 3.15 |
| TPSA | 146.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|