C26H32N8O2S — CID 143077161
1-N'-[2-hydroxy-3-[1-(4-pyrimidin-2-ylpiperazin-1-yl)ethenyl]phenyl]-2-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-sulfanylethanediimidamide (PubChem CID 143077161) has the molecular formula C26H32N8O2S and a molecular weight of 520.66 g/mol. Its IUPAC name is 1-N'-[2-hydroxy-3-[1-(4-pyrimidin-2-ylpiperazin-1-yl)ethenyl]phenyl]-2-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-sulfanylethanediimidamide.
| Compound Name | 1-N'-[2-hydroxy-3-[1-(4-pyrimidin-2-ylpiperazin-1-yl)ethenyl]phenyl]-2-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-sulfanylethanediimidamide |
|---|---|
| PubChem CID | 143077161 |
| Molecular Formula | C26H32N8O2S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 1-N'-[2-hydroxy-3-[1-(4-pyrimidin-2-ylpiperazin-1-yl)ethenyl]phenyl]-2-N'-[(1R)-1-(5-methylfuran-2-yl)propyl]-2-N-sulfanylethanediimidamide |
| SMILES | C=C(c1cccc(/N=C(N)/C(=N/[C@H](CC)c2ccc(C)o2)NS)c1O)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C26H32N8O2S/c1-4-20(22-10-9-17(2)36-22)31-25(32-37)24(27)30-21-8-5-7-19(23(21)35)18(3)33-13-15-34(16-14-33)26-28-11-6-12-29-26/h5-12,20,35,37H,3-4,13-16H2,1-2H3,(H2,27,30)(H,31,32)/t20-/m1/s1 |
| InChIKey | YQCJXLBIDZUFMS-HXUWFJFHSA-N |
| XLogP | 3.85 |
| TPSA | 128.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|