C14H17N5OS4 — CID 143077241
2-(ethylaminosulfanyl)-4-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol (PubChem CID 143077241) has the molecular formula C14H17N5OS4 and a molecular weight of 399.59 g/mol. Its IUPAC name is 2-(ethylaminosulfanyl)-4-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol.
| Compound Name | 2-(ethylaminosulfanyl)-4-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol |
|---|---|
| PubChem CID | 143077241 |
| Molecular Formula | C14H17N5OS4 |
| Molecular Weight | 399.59 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-(ethylaminosulfanyl)-4-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]thiophen-3-ol |
| SMILES | CCNSc1scc(Nc2nsnc2NCc2ccc(C)s2)c1O |
| InChI | InChI=1S/C14H17N5OS4/c1-3-16-23-14-11(20)10(7-21-14)17-13-12(18-24-19-13)15-6-9-5-4-8(2)22-9/h4-5,7,16,20H,3,6H2,1-2H3,(H,15,18)(H,17,19) |
| InChIKey | UNDSNBXAFLHTMF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.59 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|