C15H16N4OS2 — CID 142883760
2-methyl-6-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]phenol (PubChem CID 142883760) has the molecular formula C15H16N4OS2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-methyl-6-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]phenol.
| Compound Name | 2-methyl-6-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]phenol |
|---|---|
| PubChem CID | 142883760 |
| Molecular Formula | C15H16N4OS2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 2-methyl-6-[[4-[(5-methylthiophen-2-yl)methylamino]-1,2,5-thiadiazol-3-yl]amino]phenol |
| SMILES | Cc1ccc(CNc2nsnc2Nc2cccc(C)c2O)s1 |
| InChI | InChI=1S/C15H16N4OS2/c1-9-4-3-5-12(13(9)20)17-15-14(18-22-19-15)16-8-11-7-6-10(2)21-11/h3-7,20H,8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | PCWZLSHNRKRVDB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|