C12H11N3SSe — CID 43715827
N-[(5-methylthiophen-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43715827) has the molecular formula C12H11N3SSe and a molecular weight of 308.27 g/mol. Its IUPAC name is N-[(5-methylthiophen-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[(5-methylthiophen-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43715827 |
| Molecular Formula | C12H11N3SSe |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | N-[(5-methylthiophen-2-yl)methyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | Cc1ccc(CNc2cccc3n[se]nc23)s1 |
| InChI | InChI=1S/C12H11N3SSe/c1-8-5-6-9(16-8)7-13-10-3-2-4-11-12(10)15-17-14-11/h2-6,13H,7H2,1H3 |
| InChIKey | MUGHFTWHCMYYOY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|