C13H11N3O2Se — CID 43715923
4-[(2,1,3-benzoselenadiazol-4-ylamino)methyl]benzene-1,3-diol (PubChem CID 43715923) has the molecular formula C13H11N3O2Se and a molecular weight of 320.21 g/mol. Its IUPAC name is 4-[(2,1,3-benzoselenadiazol-4-ylamino)methyl]benzene-1,3-diol.
| Compound Name | 4-[(2,1,3-benzoselenadiazol-4-ylamino)methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 43715923 |
| Molecular Formula | C13H11N3O2Se |
| Molecular Weight | 320.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 4-[(2,1,3-benzoselenadiazol-4-ylamino)methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNc2cccc3n[se]nc23)c(O)c1 |
| InChI | InChI=1S/C13H11N3O2Se/c17-9-5-4-8(12(18)6-9)7-14-10-2-1-3-11-13(10)16-19-15-11/h1-6,14,17-18H,7H2 |
| InChIKey | PPGSBOJOEUPXJM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|