C13H13N3OSSe — CID 43784911
N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-2,1,3-benzoselenadiazol-4-amine (PubChem CID 43784911) has the molecular formula C13H13N3OSSe and a molecular weight of 338.29 g/mol. Its IUPAC name is N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-2,1,3-benzoselenadiazol-4-amine.
| Compound Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-2,1,3-benzoselenadiazol-4-amine |
|---|---|
| PubChem CID | 43784911 |
| Molecular Formula | C13H13N3OSSe |
| Molecular Weight | 338.29 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]-2,1,3-benzoselenadiazol-4-amine |
| SMILES | CSCc1ccc(CNc2cccc3n[se]nc23)o1 |
| InChI | InChI=1S/C13H13N3OSSe/c1-18-8-10-6-5-9(17-10)7-14-11-3-2-4-12-13(11)16-19-15-12/h2-6,14H,7-8H2,1H3 |
| InChIKey | DPVHKQHGURBZBZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|