C25H39N5O3S — CID 143077447
N-(2-hydroxyethyl)-2-[methylsulfanyl(propyl)amino]-6-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide;toluene (PubChem CID 143077447) has the molecular formula C25H39N5O3S and a molecular weight of 489.69 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-[methylsulfanyl(propyl)amino]-6-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide;toluene.
| Compound Name | N-(2-hydroxyethyl)-2-[methylsulfanyl(propyl)amino]-6-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide;toluene |
|---|---|
| PubChem CID | 143077447 |
| Molecular Formula | C25H39N5O3S |
| Molecular Weight | 489.69 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | N-(2-hydroxyethyl)-2-[methylsulfanyl(propyl)amino]-6-(2-morpholin-4-ylethylamino)pyridine-4-carboxamide;toluene |
| SMILES | CCCN(SC)c1cc(C(=O)NCCO)cc(NCCN2CCOCC2)n1.Cc1ccccc1 |
| InChI | InChI=1S/C18H31N5O3S.C7H8/c1-3-6-23(27-2)17-14-15(18(25)20-5-10-24)13-16(21-17)19-4-7-22-8-11-26-12-9-22;1-7-5-3-2-4-6-7/h13-14,24H,3-12H2,1-2H3,(H,19,21)(H,20,25);2-6H,1H3 |
| InChIKey | KOYBDMSPQUCZOM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.69 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|