C31H39N3O2 — CID 143077454
3-(2-cyanophenyl)-N,5-dipropylbenzamide;N-propylformamide;toluene (PubChem CID 143077454) has the molecular formula C31H39N3O2 and a molecular weight of 485.67 g/mol. Its IUPAC name is 3-(2-cyanophenyl)-N,5-dipropylbenzamide;N-propylformamide;toluene.
| Compound Name | 3-(2-cyanophenyl)-N,5-dipropylbenzamide;N-propylformamide;toluene |
|---|---|
| PubChem CID | 143077454 |
| Molecular Formula | C31H39N3O2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.30 |
| IUPAC Name | 3-(2-cyanophenyl)-N,5-dipropylbenzamide;N-propylformamide;toluene |
| SMILES | CCCNC(=O)c1cc(CCC)cc(-c2ccccc2C#N)c1.CCCNC=O.Cc1ccccc1 |
| InChI | InChI=1S/C20H22N2O.C7H8.C4H9NO/c1-3-7-15-11-17(19-9-6-5-8-16(19)14-21)13-18(12-15)20(23)22-10-4-2;1-7-5-3-2-4-6-7;1-2-3-5-4-6/h5-6,8-9,11-13H,3-4,7,10H2,1-2H3,(H,22,23);2-6H,1H3;4H,2-3H2,1H3,(H,5,6) |
| InChIKey | IVPNIJDZHSWVTB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|