C26H26N4O3 — CID 143127334
3-[(E)-[(Z)-(2-amino-1-methoxypropylidene)hydrazinylidene]methyl]-5-(2-cyanophenyl)benzoic acid;toluene (PubChem CID 143127334) has the molecular formula C26H26N4O3 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[(E)-[(Z)-(2-amino-1-methoxypropylidene)hydrazinylidene]methyl]-5-(2-cyanophenyl)benzoic acid;toluene.
| Compound Name | 3-[(E)-[(Z)-(2-amino-1-methoxypropylidene)hydrazinylidene]methyl]-5-(2-cyanophenyl)benzoic acid;toluene |
|---|---|
| PubChem CID | 143127334 |
| Molecular Formula | C26H26N4O3 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 3-[(E)-[(Z)-(2-amino-1-methoxypropylidene)hydrazinylidene]methyl]-5-(2-cyanophenyl)benzoic acid;toluene |
| SMILES | CO/C(=N\N=C\c1cc(C(=O)O)cc(-c2ccccc2C#N)c1)C(C)N.Cc1ccccc1 |
| InChI | InChI=1S/C19H18N4O3.C7H8/c1-12(21)18(26-2)23-22-11-13-7-15(9-16(8-13)19(24)25)17-6-4-3-5-14(17)10-20;1-7-5-3-2-4-6-7/h3-9,11-12H,21H2,1-2H3,(H,24,25);2-6H,1H3/b22-11+,23-18-; |
| InChIKey | CTRFNFAOEZHPAC-YQVDCYSFSA-N |
| XLogP | 4.64 |
| TPSA | 121.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|