C30H47NO6 — CID 143078696
[3-(nitrooxymethyl)phenyl] (Z,8R)-8,9-diethyl-12-oxononadec-5-enoate (PubChem CID 143078696) has the molecular formula C30H47NO6 and a molecular weight of 517.71 g/mol. Its IUPAC name is [3-(nitrooxymethyl)phenyl] (Z,8R)-8,9-diethyl-12-oxononadec-5-enoate.
| Compound Name | [3-(nitrooxymethyl)phenyl] (Z,8R)-8,9-diethyl-12-oxononadec-5-enoate |
|---|---|
| PubChem CID | 143078696 |
| Molecular Formula | C30H47NO6 |
| Molecular Weight | 517.71 g/mol |
| Exact Mass | 517.34 |
| IUPAC Name | [3-(nitrooxymethyl)phenyl] (Z,8R)-8,9-diethyl-12-oxononadec-5-enoate |
| SMILES | CCCCCCCC(=O)CCC(CC)[C@H](CC)C/C=C\CCCC(=O)Oc1cccc(CO[N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H47NO6/c1-4-7-8-9-13-18-28(32)22-21-27(6-3)26(5-2)17-12-10-11-14-20-30(33)37-29-19-15-16-25(23-29)24-36-31(34)35/h10,12,15-16,19,23,26-27H,4-9,11,13-14,17-18,20-22,24H2,1-3H3/b12-10-/t26-,27?/m1/s1 |
| InChIKey | JBRQREMODSIEOH-NYADDCOESA-N |
| XLogP | 8.18 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.71 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|