C10H13NS2 — CID 143079802
6-methyl-7-methylidene-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5-thione (PubChem CID 143079802) has the molecular formula C10H13NS2 and a molecular weight of 211.35 g/mol. Its IUPAC name is 6-methyl-7-methylidene-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5-thione.
| Compound Name | 6-methyl-7-methylidene-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5-thione |
|---|---|
| PubChem CID | 143079802 |
| Molecular Formula | C10H13NS2 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | 6-methyl-7-methylidene-2,3,4,4a-tetrahydrothiopyrano[3,2-c]pyridine-5-thione |
| SMILES | C=C1C=C2SCCCC2C(=S)N1C |
| InChI | InChI=1S/C10H13NS2/c1-7-6-9-8(4-3-5-13-9)10(12)11(7)2/h6,8H,1,3-5H2,2H3 |
| InChIKey | DAFFUDWXOOYFHQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|