C9H11NS2 — CID 142927924
5-methyl-6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione (PubChem CID 142927924) has the molecular formula C9H11NS2 and a molecular weight of 197.33 g/mol. Its IUPAC name is 5-methyl-6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione.
| Compound Name | 5-methyl-6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione |
|---|---|
| PubChem CID | 142927924 |
| Molecular Formula | C9H11NS2 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 5-methyl-6-methylidene-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4-thione |
| SMILES | C=C1C=C2SCCC2C(=S)N1C |
| InChI | InChI=1S/C9H11NS2/c1-6-5-8-7(3-4-12-8)9(11)10(6)2/h5,7H,1,3-4H2,2H3 |
| InChIKey | XVZCKUDWNXZNQF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|