C10H13NS3 — CID 142135833
5-propyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 142135833) has the molecular formula C10H13NS3 and a molecular weight of 243.42 g/mol. Its IUPAC name is 5-propyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-propyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 142135833 |
| Molecular Formula | C10H13NS3 |
| Molecular Weight | 243.42 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | 5-propyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CCCN1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C10H13NS3/c1-2-4-11-9(12)6-8-7(10(11)13)3-5-14-8/h6-7H,2-5H2,1H3 |
| InChIKey | HMIWZPHJRPQBPR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|