C10H15NS3 — CID 142135863
ethane;5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 142135863) has the molecular formula C10H15NS3 and a molecular weight of 245.44 g/mol. Its IUPAC name is ethane;5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | ethane;5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 142135863 |
| Molecular Formula | C10H15NS3 |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | ethane;5-methyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CC.CN1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C8H9NS3.C2H6/c1-9-7(10)4-6-5(8(9)11)2-3-12-6;1-2/h4-5H,2-3H2,1H3;1-2H3 |
| InChIKey | FIHNGSQTKKJBKM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|