C9H13NS3 — CID 142927970
4-ethylsulfanyl-1,3-dimethyl-3H-pyridine-2,6-dithione (PubChem CID 142927970) has the molecular formula C9H13NS3 and a molecular weight of 231.41 g/mol. Its IUPAC name is 4-ethylsulfanyl-1,3-dimethyl-3H-pyridine-2,6-dithione.
| Compound Name | 4-ethylsulfanyl-1,3-dimethyl-3H-pyridine-2,6-dithione |
|---|---|
| PubChem CID | 142927970 |
| Molecular Formula | C9H13NS3 |
| Molecular Weight | 231.41 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 4-ethylsulfanyl-1,3-dimethyl-3H-pyridine-2,6-dithione |
| SMILES | CCSC1=CC(=S)N(C)C(=S)C1C |
| InChI | InChI=1S/C9H13NS3/c1-4-13-7-5-8(11)10(3)9(12)6(7)2/h5-6H,4H2,1-3H3 |
| InChIKey | IKASMCRALOKOHL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|