C8H11NS3 — CID 142212042
1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione (PubChem CID 142212042) has the molecular formula C8H11NS3 and a molecular weight of 217.38 g/mol. Its IUPAC name is 1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione.
| Compound Name | 1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione |
|---|---|
| PubChem CID | 142212042 |
| Molecular Formula | C8H11NS3 |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione |
| SMILES | CSC1=CC(=S)N(C)C(=S)C1C |
| InChI | InChI=1S/C8H11NS3/c1-5-6(12-3)4-7(10)9(2)8(5)11/h4-5H,1-3H3 |
| InChIKey | SBMBSYYQBYSKOV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|