C11H17NS3 — CID 165116395
3-ethyl-4-methylsulfanyl-1-propan-2-yl-3H-pyridine-2,6-dithione (PubChem CID 165116395) has the molecular formula C11H17NS3 and a molecular weight of 259.46 g/mol. Its IUPAC name is 3-ethyl-4-methylsulfanyl-1-propan-2-yl-3H-pyridine-2,6-dithione.
| Compound Name | 3-ethyl-4-methylsulfanyl-1-propan-2-yl-3H-pyridine-2,6-dithione |
|---|---|
| PubChem CID | 165116395 |
| Molecular Formula | C11H17NS3 |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 3-ethyl-4-methylsulfanyl-1-propan-2-yl-3H-pyridine-2,6-dithione |
| SMILES | CCC1C(=S)N(C(C)C)C(=S)C=C1SC |
| InChI | InChI=1S/C11H17NS3/c1-5-8-9(15-4)6-10(13)12(7(2)3)11(8)14/h6-8H,5H2,1-4H3 |
| InChIKey | GAJZRFJHZGAOEA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|