C12H19NS3 — CID 165116312
4-methyl-4-methylsulfanyl-5-propan-2-yl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-6-thione (PubChem CID 165116312) has the molecular formula C12H19NS3 and a molecular weight of 273.49 g/mol. Its IUPAC name is 4-methyl-4-methylsulfanyl-5-propan-2-yl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-6-thione.
| Compound Name | 4-methyl-4-methylsulfanyl-5-propan-2-yl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-6-thione |
|---|---|
| PubChem CID | 165116312 |
| Molecular Formula | C12H19NS3 |
| Molecular Weight | 273.49 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-methyl-4-methylsulfanyl-5-propan-2-yl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-6-thione |
| SMILES | CSC1(C)C2CCSC2=CC(=S)N1C(C)C |
| InChI | InChI=1S/C12H19NS3/c1-8(2)13-11(14)7-10-9(5-6-16-10)12(13,3)15-4/h7-9H,5-6H2,1-4H3 |
| InChIKey | GUJGDXHJHKAOGS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|