C12H17NS3 — CID 146915300
5-(2-methylbutan-2-yl)-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 146915300) has the molecular formula C12H17NS3 and a molecular weight of 271.48 g/mol. Its IUPAC name is 5-(2-methylbutan-2-yl)-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-(2-methylbutan-2-yl)-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 146915300 |
| Molecular Formula | C12H17NS3 |
| Molecular Weight | 271.48 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | 5-(2-methylbutan-2-yl)-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | CCC(C)(C)N1C(=S)C=C2SCCC2C1=S |
| InChI | InChI=1S/C12H17NS3/c1-4-12(2,3)13-10(14)7-9-8(11(13)15)5-6-16-9/h7-8H,4-6H2,1-3H3 |
| InChIKey | ACCPOXLRUDEJCD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.48 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|