C11H17NS3 — CID 142135477
5-tert-butyl-4-sulfanyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione (PubChem CID 142135477) has the molecular formula C11H17NS3 and a molecular weight of 259.46 g/mol. Its IUPAC name is 5-tert-butyl-4-sulfanyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione.
| Compound Name | 5-tert-butyl-4-sulfanyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione |
|---|---|
| PubChem CID | 142135477 |
| Molecular Formula | C11H17NS3 |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 5-tert-butyl-4-sulfanyl-2,3,3a,4-tetrahydrothieno[3,2-c]pyridine-6-thione |
| SMILES | CC(C)(C)N1C(=S)C=C2SCCC2C1S |
| InChI | InChI=1S/C11H17NS3/c1-11(2,3)12-9(13)6-8-7(10(12)14)4-5-15-8/h6-7,10,14H,4-5H2,1-3H3 |
| InChIKey | QJPHWHPVTVXFHJ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|