C12H21NS3 — CID 143080095
ethane;3-ethyl-4-ethylsulfanyl-1-methyl-3H-pyridine-2,6-dithione (PubChem CID 143080095) has the molecular formula C12H21NS3 and a molecular weight of 275.51 g/mol. Its IUPAC name is ethane;3-ethyl-4-ethylsulfanyl-1-methyl-3H-pyridine-2,6-dithione.
| Compound Name | ethane;3-ethyl-4-ethylsulfanyl-1-methyl-3H-pyridine-2,6-dithione |
|---|---|
| PubChem CID | 143080095 |
| Molecular Formula | C12H21NS3 |
| Molecular Weight | 275.51 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | ethane;3-ethyl-4-ethylsulfanyl-1-methyl-3H-pyridine-2,6-dithione |
| SMILES | CC.CCSC1=CC(=S)N(C)C(=S)C1CC |
| InChI | InChI=1S/C10H15NS3.C2H6/c1-4-7-8(14-5-2)6-9(12)11(3)10(7)13;1-2/h6-7H,4-5H2,1-3H3;1-2H3 |
| InChIKey | VIXMODKALAYKEQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|