C10H17NS3 — CID 142927882
1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione;ethane (PubChem CID 142927882) has the molecular formula C10H17NS3 and a molecular weight of 247.45 g/mol. Its IUPAC name is 1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione;ethane.
| Compound Name | 1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione;ethane |
|---|---|
| PubChem CID | 142927882 |
| Molecular Formula | C10H17NS3 |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | 1,3-dimethyl-4-methylsulfanyl-3H-pyridine-2,6-dithione;ethane |
| SMILES | CC.CSC1=CC(=S)N(C)C(=S)C1C |
| InChI | InChI=1S/C8H11NS3.C2H6/c1-5-6(12-3)4-7(10)9(2)8(5)11;1-2/h4-5H,1-3H3;1-2H3 |
| InChIKey | JINVKSKJUQNPNB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|