C8H11NS3 — CID 154549853
5-methyl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione (PubChem CID 154549853) has the molecular formula C8H11NS3 and a molecular weight of 217.38 g/mol. Its IUPAC name is 5-methyl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione.
| Compound Name | 5-methyl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione |
|---|---|
| PubChem CID | 154549853 |
| Molecular Formula | C8H11NS3 |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | 5-methyl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione |
| SMILES | CN1C(=S)C2CCSC2=CC1S |
| InChI | InChI=1S/C8H11NS3/c1-9-7(10)4-6-5(8(9)11)2-3-12-6/h4-5,7,10H,2-3H2,1H3 |
| InChIKey | HKLSNFJNQRGBGA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|