C11H13NS3 — CID 164594983
5-cyclobutyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione (PubChem CID 164594983) has the molecular formula C11H13NS3 and a molecular weight of 255.43 g/mol. Its IUPAC name is 5-cyclobutyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione.
| Compound Name | 5-cyclobutyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
|---|---|
| PubChem CID | 164594983 |
| Molecular Formula | C11H13NS3 |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | 5-cyclobutyl-3,3a-dihydro-2H-thieno[3,2-c]pyridine-4,6-dithione |
| SMILES | S=C1C=C2SCCC2C(=S)N1C1CCC1 |
| InChI | InChI=1S/C11H13NS3/c13-10-6-9-8(4-5-15-9)11(14)12(10)7-2-1-3-7/h6-8H,1-5H2 |
| InChIKey | VZZAPVLJSDBUIX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|